C17H17ClO3 — CID 100528397
(2S)-2-(3-chlorophenoxy)-3-(3,4-dimethylphenyl)propanoic acid (PubChem CID 100528397) has the molecular formula C17H17ClO3 and a molecular weight of 304.77 g/mol. Its IUPAC name is (2S)-2-(3-chlorophenoxy)-3-(3,4-dimethylphenyl)propanoic acid.
| Compound Name | (2S)-2-(3-chlorophenoxy)-3-(3,4-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 100528397 |
| Molecular Formula | C17H17ClO3 |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (2S)-2-(3-chlorophenoxy)-3-(3,4-dimethylphenyl)propanoic acid |
| SMILES | Cc1ccc(C[C@H](Oc2cccc(Cl)c2)C(=O)O)cc1C |
| InChI | InChI=1S/C17H17ClO3/c1-11-6-7-13(8-12(11)2)9-16(17(19)20)21-15-5-3-4-14(18)10-15/h3-8,10,16H,9H2,1-2H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | ZWVZJUZGERCFJM-INIZCTEOSA-N |
| XLogP | 4.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |