C21H17ClO4 — CID 100544750
(2R)-2-(3-chlorophenoxy)-3-(4-phenoxyphenyl)propanoic acid (PubChem CID 100544750) has the molecular formula C21H17ClO4 and a molecular weight of 368.82 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenoxy)-3-(4-phenoxyphenyl)propanoic acid.
| Compound Name | (2R)-2-(3-chlorophenoxy)-3-(4-phenoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 100544750 |
| Molecular Formula | C21H17ClO4 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | (2R)-2-(3-chlorophenoxy)-3-(4-phenoxyphenyl)propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccc(Oc2ccccc2)cc1)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H17ClO4/c22-16-5-4-8-19(14-16)26-20(21(23)24)13-15-9-11-18(12-10-15)25-17-6-2-1-3-7-17/h1-12,14,20H,13H2,(H,23,24)/t20-/m1/s1 |
| InChIKey | OWGJQIIMYRBZCH-HXUWFJFHSA-N |
| XLogP | 5.21 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |