C15H12ClIO3 — CID 100535710
(2R)-2-(3-chlorophenoxy)-3-(4-iodophenyl)propanoic acid (PubChem CID 100535710) has the molecular formula C15H12ClIO3 and a molecular weight of 402.62 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenoxy)-3-(4-iodophenyl)propanoic acid.
| Compound Name | (2R)-2-(3-chlorophenoxy)-3-(4-iodophenyl)propanoic acid |
|---|---|
| PubChem CID | 100535710 |
| Molecular Formula | C15H12ClIO3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 401.95 |
| IUPAC Name | (2R)-2-(3-chlorophenoxy)-3-(4-iodophenyl)propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccc(I)cc1)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H12ClIO3/c16-11-2-1-3-13(9-11)20-14(15(18)19)8-10-4-6-12(17)7-5-10/h1-7,9,14H,8H2,(H,18,19)/t14-/m1/s1 |
| InChIKey | QPHNUNGTGALYLW-CQSZACIVSA-N |
| XLogP | 4.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|