C16H15IO3 — CID 100535647
(2S)-3-(4-iodophenyl)-2-(3-methylphenoxy)propanoic acid (PubChem CID 100535647) has the molecular formula C16H15IO3 and a molecular weight of 382.20 g/mol. Its IUPAC name is (2S)-3-(4-iodophenyl)-2-(3-methylphenoxy)propanoic acid.
| Compound Name | (2S)-3-(4-iodophenyl)-2-(3-methylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 100535647 |
| Molecular Formula | C16H15IO3 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | (2S)-3-(4-iodophenyl)-2-(3-methylphenoxy)propanoic acid |
| SMILES | Cc1cccc(O[C@@H](Cc2ccc(I)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C16H15IO3/c1-11-3-2-4-14(9-11)20-15(16(18)19)10-12-5-7-13(17)8-6-12/h2-9,15H,10H2,1H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | ZWHPNXWRJGYFND-HNNXBMFYSA-N |
| XLogP | 3.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|