C18H19IO3 — CID 100535930
(2R)-3-(4-iodophenyl)-2-(2,3,5-trimethylphenoxy)propanoic acid (PubChem CID 100535930) has the molecular formula C18H19IO3 and a molecular weight of 410.25 g/mol. Its IUPAC name is (2R)-3-(4-iodophenyl)-2-(2,3,5-trimethylphenoxy)propanoic acid.
| Compound Name | (2R)-3-(4-iodophenyl)-2-(2,3,5-trimethylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 100535930 |
| Molecular Formula | C18H19IO3 |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | (2R)-3-(4-iodophenyl)-2-(2,3,5-trimethylphenoxy)propanoic acid |
| SMILES | Cc1cc(C)c(C)c(O[C@H](Cc2ccc(I)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C18H19IO3/c1-11-8-12(2)13(3)16(9-11)22-17(18(20)21)10-14-4-6-15(19)7-5-14/h4-9,17H,10H2,1-3H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | FMMQYLNDKMVTFL-QGZVFWFLSA-N |
| XLogP | 4.29 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|