C20H24O5 — CID 100545560
(2S)-3-(2,4-dimethoxyphenyl)-2-(2,3,5-trimethylphenoxy)propanoic acid (PubChem CID 100545560) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is (2S)-3-(2,4-dimethoxyphenyl)-2-(2,3,5-trimethylphenoxy)propanoic acid.
| Compound Name | (2S)-3-(2,4-dimethoxyphenyl)-2-(2,3,5-trimethylphenoxy)propanoic acid |
|---|---|
| PubChem CID | 100545560 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | (2S)-3-(2,4-dimethoxyphenyl)-2-(2,3,5-trimethylphenoxy)propanoic acid |
| SMILES | COc1ccc(C[C@H](Oc2cc(C)cc(C)c2C)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C20H24O5/c1-12-8-13(2)14(3)17(9-12)25-19(20(21)22)10-15-6-7-16(23-4)11-18(15)24-5/h6-9,11,19H,10H2,1-5H3,(H,21,22)/t19-/m0/s1 |
| InChIKey | FHXNXCVFRBYYFY-IBGZPJMESA-N |
| XLogP | 3.70 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |