C18H19ClO5 — CID 100546009
(2R)-2-(4-chloro-3-methylphenoxy)-3-(2,5-dimethoxyphenyl)propanoic acid (PubChem CID 100546009) has the molecular formula C18H19ClO5 and a molecular weight of 350.80 g/mol. Its IUPAC name is (2R)-2-(4-chloro-3-methylphenoxy)-3-(2,5-dimethoxyphenyl)propanoic acid.
| Compound Name | (2R)-2-(4-chloro-3-methylphenoxy)-3-(2,5-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 100546009 |
| Molecular Formula | C18H19ClO5 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | (2R)-2-(4-chloro-3-methylphenoxy)-3-(2,5-dimethoxyphenyl)propanoic acid |
| SMILES | COc1ccc(OC)c(C[C@@H](Oc2ccc(Cl)c(C)c2)C(=O)O)c1 |
| InChI | InChI=1S/C18H19ClO5/c1-11-8-14(4-6-15(11)19)24-17(18(20)21)10-12-9-13(22-2)5-7-16(12)23-3/h4-9,17H,10H2,1-3H3,(H,20,21)/t17-/m1/s1 |
| InChIKey | VRKWPRBBTOCSMS-QGZVFWFLSA-N |
| XLogP | 3.74 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |