C16H14Cl2O4 — CID 100547133
(2S)-3-(5-chloro-2-methoxyphenyl)-2-(4-chlorophenoxy)propanoic acid (PubChem CID 100547133) has the molecular formula C16H14Cl2O4 and a molecular weight of 341.19 g/mol. Its IUPAC name is (2S)-3-(5-chloro-2-methoxyphenyl)-2-(4-chlorophenoxy)propanoic acid.
| Compound Name | (2S)-3-(5-chloro-2-methoxyphenyl)-2-(4-chlorophenoxy)propanoic acid |
|---|---|
| PubChem CID | 100547133 |
| Molecular Formula | C16H14Cl2O4 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | (2S)-3-(5-chloro-2-methoxyphenyl)-2-(4-chlorophenoxy)propanoic acid |
| SMILES | COc1ccc(Cl)cc1C[C@H](Oc1ccc(Cl)cc1)C(=O)O |
| InChI | InChI=1S/C16H14Cl2O4/c1-21-14-7-4-12(18)8-10(14)9-15(16(19)20)22-13-5-2-11(17)3-6-13/h2-8,15H,9H2,1H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | YBOJPAHXKLCLPX-HNNXBMFYSA-N |
| XLogP | 4.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |