C17H17ClO5 — CID 100545345
(2R)-2-(4-chlorophenoxy)-3-(2,4-dimethoxyphenyl)propanoic acid (PubChem CID 100545345) has the molecular formula C17H17ClO5 and a molecular weight of 336.77 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenoxy)-3-(2,4-dimethoxyphenyl)propanoic acid.
| Compound Name | (2R)-2-(4-chlorophenoxy)-3-(2,4-dimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 100545345 |
| Molecular Formula | C17H17ClO5 |
| Molecular Weight | 336.77 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (2R)-2-(4-chlorophenoxy)-3-(2,4-dimethoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C[C@@H](Oc2ccc(Cl)cc2)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C17H17ClO5/c1-21-14-6-3-11(15(10-14)22-2)9-16(17(19)20)23-13-7-4-12(18)5-8-13/h3-8,10,16H,9H2,1-2H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | PZXIKGNXAMRORQ-MRXNPFEDSA-N |
| XLogP | 3.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.77 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |