(2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid

C14H20O5 — CID 100545736

IUPAC(2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid
SMILESCOc1ccc(C[C@@H](OC(C)C)C(=O)O)c(OC)c1
InChIInChI=1S/C14H20O5/c1-9(2)19-13(14(15)16)7-10-5-6-11(17-3)8-12(10)18-4/h5-6,8-9,13H,7H2,1-4H3,(H,15,16)/t13-/m1/s1
InChIKeyXEFFUTXPNXUOAS-CYBMUJFWSA-N
MW268.31 g/mol
LogP2.12
Rot. Bonds7

About (2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid

(2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid (PubChem CID 100545736) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is (2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid.

Molecular Properties

Compound Name(2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid
PubChem CID100545736
Molecular FormulaC14H20O5
Molecular Weight268.31 g/mol
Exact Mass268.13
IUPAC Name(2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid
SMILESCOc1ccc(C[C@@H](OC(C)C)C(=O)O)c(OC)c1
InChIInChI=1S/C14H20O5/c1-9(2)19-13(14(15)16)7-10-5-6-11(17-3)8-12(10)18-4/h5-6,8-9,13H,7H2,1-4H3,(H,15,16)/t13-/m1/s1
InChIKeyXEFFUTXPNXUOAS-CYBMUJFWSA-N
XLogP2.12
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.31
LogP ≤ 52.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze (2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid?
The IUPAC name of (2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid (CID 100545736) is (2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid.
What is the SMILES notation for (2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid?
The canonical SMILES for (2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid is COc1ccc(C[C@@H](OC(C)C)C(=O)O)c(OC)c1.
What is the InChIKey of (2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid?
The InChIKey is XEFFUTXPNXUOAS-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H20O5/c1-9(2)19-13(14(15)16)7-10-5-6-11(17-3)8-12(10)18-4/h5-6,8-9,13H,7H2,1-4H3,(H,15,16)/t13-/m1/s1.
What are the key properties of (2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid?
(2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid has a molecular weight of 268.31 g/mol, XLogP of 2.12, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-(2,4-dimethoxyphenyl)-2-propan-2-yloxypropanoic acid is sourced from PubChem (CID 100545736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).