3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid

C14H20O5 — CID 133241144

IUPAC3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid
SMILESCCCOC(Cc1ccc(OC)cc1OC)C(=O)O
InChIInChI=1S/C14H20O5/c1-4-7-19-13(14(15)16)8-10-5-6-11(17-2)9-12(10)18-3/h5-6,9,13H,4,7-8H2,1-3H3,(H,15,16)
InChIKeyABETWDSHLNNBEK-UHFFFAOYSA-N
MW268.31 g/mol
LogP2.13
Rot. Bonds8

About 3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid

3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid (PubChem CID 133241144) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid.

Molecular Properties

Compound Name3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid
PubChem CID133241144
Molecular FormulaC14H20O5
Molecular Weight268.31 g/mol
Exact Mass268.13
IUPAC Name3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid
SMILESCCCOC(Cc1ccc(OC)cc1OC)C(=O)O
InChIInChI=1S/C14H20O5/c1-4-7-19-13(14(15)16)8-10-5-6-11(17-2)9-12(10)18-3/h5-6,9,13H,4,7-8H2,1-3H3,(H,15,16)
InChIKeyABETWDSHLNNBEK-UHFFFAOYSA-N
XLogP2.13
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.31
LogP ≤ 52.13
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid?
The IUPAC name of 3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid (CID 133241144) is 3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid.
What is the SMILES notation for 3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid?
The canonical SMILES for 3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid is CCCOC(Cc1ccc(OC)cc1OC)C(=O)O.
What is the InChIKey of 3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid?
The InChIKey is ABETWDSHLNNBEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O5/c1-4-7-19-13(14(15)16)8-10-5-6-11(17-2)9-12(10)18-3/h5-6,9,13H,4,7-8H2,1-3H3,(H,15,16).
What are the key properties of 3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid?
3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid has a molecular weight of 268.31 g/mol, XLogP of 2.13, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dimethoxyphenyl)-2-propoxypropanoic acid is sourced from PubChem (CID 133241144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).