C18H20O5 — CID 100546415
(2S)-3-(2,5-dimethoxyphenyl)-2-phenylmethoxypropanoic acid (PubChem CID 100546415) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is (2S)-3-(2,5-dimethoxyphenyl)-2-phenylmethoxypropanoic acid.
| Compound Name | (2S)-3-(2,5-dimethoxyphenyl)-2-phenylmethoxypropanoic acid |
|---|---|
| PubChem CID | 100546415 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (2S)-3-(2,5-dimethoxyphenyl)-2-phenylmethoxypropanoic acid |
| SMILES | COc1ccc(OC)c(C[C@H](OCc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C18H20O5/c1-21-15-8-9-16(22-2)14(10-15)11-17(18(19)20)23-12-13-6-4-3-5-7-13/h3-10,17H,11-12H2,1-2H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | YRFVNLRSSNLHGT-KRWDZBQOSA-N |
| XLogP | 2.92 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |