C23H22O4 — CID 122390059
(2R)-2-phenylmethoxy-3-(4-phenylmethoxyphenyl)propanoic acid (PubChem CID 122390059) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is (2R)-2-phenylmethoxy-3-(4-phenylmethoxyphenyl)propanoic acid.
| Compound Name | (2R)-2-phenylmethoxy-3-(4-phenylmethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 122390059 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | (2R)-2-phenylmethoxy-3-(4-phenylmethoxyphenyl)propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccc(OCc2ccccc2)cc1)OCc1ccccc1 |
| InChI | InChI=1S/C23H22O4/c24-23(25)22(27-17-20-9-5-2-6-10-20)15-18-11-13-21(14-12-18)26-16-19-7-3-1-4-8-19/h1-14,22H,15-17H2,(H,24,25)/t22-/m1/s1 |
| InChIKey | BPYVSPXCPDRFDO-JOCHJYFZSA-N |
| XLogP | 4.48 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |