C18H22ClNO4 — CID 90468820
(2S)-2-ethoxy-N-hydroxy-3-(4-phenylmethoxyphenyl)propanamide;hydrochloride (PubChem CID 90468820) has the molecular formula C18H22ClNO4 and a molecular weight of 351.83 g/mol. Its IUPAC name is (2S)-2-ethoxy-N-hydroxy-3-(4-phenylmethoxyphenyl)propanamide;hydrochloride.
| Compound Name | (2S)-2-ethoxy-N-hydroxy-3-(4-phenylmethoxyphenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 90468820 |
| Molecular Formula | C18H22ClNO4 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (2S)-2-ethoxy-N-hydroxy-3-(4-phenylmethoxyphenyl)propanamide;hydrochloride |
| SMILES | CCO[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)NO.Cl |
| InChI | InChI=1S/C18H21NO4.ClH/c1-2-22-17(18(20)19-21)12-14-8-10-16(11-9-14)23-13-15-6-4-3-5-7-15;/h3-11,17,21H,2,12-13H2,1H3,(H,19,20);1H/t17-;/m0./s1 |
| InChIKey | BJENHWABVBPBQK-LMOVPXPDSA-N |
| XLogP | 3.14 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|