C23H30O4 — CID 54519655
methyl 2-hexoxy-3-(4-phenylmethoxyphenyl)propanoate (PubChem CID 54519655) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is methyl 2-hexoxy-3-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | methyl 2-hexoxy-3-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 54519655 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | methyl 2-hexoxy-3-(4-phenylmethoxyphenyl)propanoate |
| SMILES | CCCCCCOC(Cc1ccc(OCc2ccccc2)cc1)C(=O)OC |
| InChI | InChI=1S/C23H30O4/c1-3-4-5-9-16-26-22(23(24)25-2)17-19-12-14-21(15-13-19)27-18-20-10-7-6-8-11-20/h6-8,10-15,22H,3-5,9,16-18H2,1-2H3 |
| InChIKey | YOWLEUBIACATTC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|