C20H25NO6 — CID 90468822
(2R)-2-ethoxy-N-hydroxy-3-[4-[(2S)-2-hydroxy-2-(3-methoxyphenyl)ethoxy]phenyl]propanamide (PubChem CID 90468822) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is (2R)-2-ethoxy-N-hydroxy-3-[4-[(2S)-2-hydroxy-2-(3-methoxyphenyl)ethoxy]phenyl]propanamide.
| Compound Name | (2R)-2-ethoxy-N-hydroxy-3-[4-[(2S)-2-hydroxy-2-(3-methoxyphenyl)ethoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 90468822 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | (2R)-2-ethoxy-N-hydroxy-3-[4-[(2S)-2-hydroxy-2-(3-methoxyphenyl)ethoxy]phenyl]propanamide |
| SMILES | CCO[C@H](Cc1ccc(OC[C@@H](O)c2cccc(OC)c2)cc1)C(=O)NO |
| InChI | InChI=1S/C20H25NO6/c1-3-26-19(20(23)21-24)11-14-7-9-16(10-8-14)27-13-18(22)15-5-4-6-17(12-15)25-2/h4-10,12,18-19,22,24H,3,11,13H2,1-2H3,(H,21,23)/t18-,19-/m1/s1 |
| InChIKey | WDTFEULCRJBWDO-RTBURBONSA-N |
| XLogP | 2.26 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|