C22H28O5 — CID 118902202
ethyl 2-ethoxy-3-[4-[2-hydroxy-2-(3-methylphenyl)ethoxy]phenyl]propanoate (PubChem CID 118902202) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is ethyl 2-ethoxy-3-[4-[2-hydroxy-2-(3-methylphenyl)ethoxy]phenyl]propanoate.
| Compound Name | ethyl 2-ethoxy-3-[4-[2-hydroxy-2-(3-methylphenyl)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 118902202 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | ethyl 2-ethoxy-3-[4-[2-hydroxy-2-(3-methylphenyl)ethoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OCC(O)c2cccc(C)c2)cc1)OCC |
| InChI | InChI=1S/C22H28O5/c1-4-25-21(22(24)26-5-2)14-17-9-11-19(12-10-17)27-15-20(23)18-8-6-7-16(3)13-18/h6-13,20-21,23H,4-5,14-15H2,1-3H3 |
| InChIKey | UXUPAHJPSWELAZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |