C16H24O7S — CID 162640114
ethyl (2S)-2-ethoxy-3-[4-(2-methylsulfonyloxyethoxy)phenyl]propanoate (PubChem CID 162640114) has the molecular formula C16H24O7S and a molecular weight of 360.43 g/mol. Its IUPAC name is ethyl (2S)-2-ethoxy-3-[4-(2-methylsulfonyloxyethoxy)phenyl]propanoate.
| Compound Name | ethyl (2S)-2-ethoxy-3-[4-(2-methylsulfonyloxyethoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 162640114 |
| Molecular Formula | C16H24O7S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | ethyl (2S)-2-ethoxy-3-[4-(2-methylsulfonyloxyethoxy)phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(OCCOS(C)(=O)=O)cc1)OCC |
| InChI | InChI=1S/C16H24O7S/c1-4-20-15(16(17)21-5-2)12-13-6-8-14(9-7-13)22-10-11-23-24(3,18)19/h6-9,15H,4-5,10-12H2,1-3H3/t15-/m0/s1 |
| InChIKey | QAMDMHWKODDAQE-HNNXBMFYSA-N |
| XLogP | 1.55 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|