C26H35NO5 — CID 54418983
ethyl 2-ethoxy-3-[4-[2-[4-[methyl(2-methylpropanoyl)amino]phenyl]ethoxy]phenyl]propanoate (PubChem CID 54418983) has the molecular formula C26H35NO5 and a molecular weight of 441.57 g/mol. Its IUPAC name is ethyl 2-ethoxy-3-[4-[2-[4-[methyl(2-methylpropanoyl)amino]phenyl]ethoxy]phenyl]propanoate.
| Compound Name | ethyl 2-ethoxy-3-[4-[2-[4-[methyl(2-methylpropanoyl)amino]phenyl]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 54418983 |
| Molecular Formula | C26H35NO5 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | ethyl 2-ethoxy-3-[4-[2-[4-[methyl(2-methylpropanoyl)amino]phenyl]ethoxy]phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OCCc2ccc(N(C)C(=O)C(C)C)cc2)cc1)OCC |
| InChI | InChI=1S/C26H35NO5/c1-6-30-24(26(29)31-7-2)18-21-10-14-23(15-11-21)32-17-16-20-8-12-22(13-9-20)27(5)25(28)19(3)4/h8-15,19,24H,6-7,16-18H2,1-5H3 |
| InChIKey | VZLSRKYOGPYVEJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |