C15H22O3 — CID 142845050
propyl 2-ethoxy-3-(4-methylphenyl)propanoate (PubChem CID 142845050) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is propyl 2-ethoxy-3-(4-methylphenyl)propanoate.
| Compound Name | propyl 2-ethoxy-3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 142845050 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | propyl 2-ethoxy-3-(4-methylphenyl)propanoate |
| SMILES | CCCOC(=O)C(Cc1ccc(C)cc1)OCC |
| InChI | InChI=1S/C15H22O3/c1-4-10-18-15(16)14(17-5-2)11-13-8-6-12(3)7-9-13/h6-9,14H,4-5,10-11H2,1-3H3 |
| InChIKey | BKYJAIDBNFMQHO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |