C18H20O4 — CID 18626029
ethyl 3-(4-hydroxyphenyl)-2-(4-methylphenoxy)propanoate (PubChem CID 18626029) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is ethyl 3-(4-hydroxyphenyl)-2-(4-methylphenoxy)propanoate.
| Compound Name | ethyl 3-(4-hydroxyphenyl)-2-(4-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 18626029 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | ethyl 3-(4-hydroxyphenyl)-2-(4-methylphenoxy)propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(O)cc1)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C18H20O4/c1-3-21-18(20)17(12-14-6-8-15(19)9-7-14)22-16-10-4-13(2)5-11-16/h4-11,17,19H,3,12H2,1-2H3 |
| InChIKey | WKRCUDDHLZJUDX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |