C24H23ClO4 — CID 18625711
ethyl 2-(4-chlorophenoxy)-3-(4-phenylmethoxyphenyl)propanoate (PubChem CID 18625711) has the molecular formula C24H23ClO4 and a molecular weight of 410.90 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenoxy)-3-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | ethyl 2-(4-chlorophenoxy)-3-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 18625711 |
| Molecular Formula | C24H23ClO4 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | ethyl 2-(4-chlorophenoxy)-3-(4-phenylmethoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OCc2ccccc2)cc1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClO4/c1-2-27-24(26)23(29-22-14-10-20(25)11-15-22)16-18-8-12-21(13-9-18)28-17-19-6-4-3-5-7-19/h3-15,23H,2,16-17H2,1H3 |
| InChIKey | XELISUIWFCPBOW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |