C32H30ClNO5 — CID 18626003
ethyl 3-[4-[2-[[4-(4-chlorophenyl)benzoyl]amino]ethoxy]phenyl]-2-phenoxypropanoate (PubChem CID 18626003) has the molecular formula C32H30ClNO5 and a molecular weight of 544.05 g/mol. Its IUPAC name is ethyl 3-[4-[2-[[4-(4-chlorophenyl)benzoyl]amino]ethoxy]phenyl]-2-phenoxypropanoate.
| Compound Name | ethyl 3-[4-[2-[[4-(4-chlorophenyl)benzoyl]amino]ethoxy]phenyl]-2-phenoxypropanoate |
|---|---|
| PubChem CID | 18626003 |
| Molecular Formula | C32H30ClNO5 |
| Molecular Weight | 544.05 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | ethyl 3-[4-[2-[[4-(4-chlorophenyl)benzoyl]amino]ethoxy]phenyl]-2-phenoxypropanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OCCNC(=O)c2ccc(-c3ccc(Cl)cc3)cc2)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C32H30ClNO5/c1-2-37-32(36)30(39-29-6-4-3-5-7-29)22-23-8-18-28(19-9-23)38-21-20-34-31(35)26-12-10-24(11-13-26)25-14-16-27(33)17-15-25/h3-19,30H,2,20-22H2,1H3,(H,34,35) |
| InChIKey | HZODGWLZKLEUIS-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.05 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|