C33H34N2O5 — CID 18625702
ethyl 4-phenoxy-2-[[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]methyl]butanoate (PubChem CID 18625702) has the molecular formula C33H34N2O5 and a molecular weight of 538.64 g/mol. Its IUPAC name is ethyl 4-phenoxy-2-[[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]methyl]butanoate.
| Compound Name | ethyl 4-phenoxy-2-[[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]methyl]butanoate |
|---|---|
| PubChem CID | 18625702 |
| Molecular Formula | C33H34N2O5 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | ethyl 4-phenoxy-2-[[4-[2-[(4-pyridin-2-ylbenzoyl)amino]ethoxy]phenyl]methyl]butanoate |
| SMILES | CCOC(=O)C(CCOc1ccccc1)Cc1ccc(OCCNC(=O)c2ccc(-c3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C33H34N2O5/c1-2-38-33(37)28(19-22-39-29-8-4-3-5-9-29)24-25-11-17-30(18-12-25)40-23-21-35-32(36)27-15-13-26(14-16-27)31-10-6-7-20-34-31/h3-18,20,28H,2,19,21-24H2,1H3,(H,35,36) |
| InChIKey | USGIFYDOCUNIBX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|