C30H35NO5 — CID 18625857
ethyl 2-[[4-[2-[[4-(4-hydroxyphenyl)benzoyl]amino]ethoxy]phenyl]methyl]hexanoate (PubChem CID 18625857) has the molecular formula C30H35NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is ethyl 2-[[4-[2-[[4-(4-hydroxyphenyl)benzoyl]amino]ethoxy]phenyl]methyl]hexanoate.
| Compound Name | ethyl 2-[[4-[2-[[4-(4-hydroxyphenyl)benzoyl]amino]ethoxy]phenyl]methyl]hexanoate |
|---|---|
| PubChem CID | 18625857 |
| Molecular Formula | C30H35NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | ethyl 2-[[4-[2-[[4-(4-hydroxyphenyl)benzoyl]amino]ethoxy]phenyl]methyl]hexanoate |
| SMILES | CCCCC(Cc1ccc(OCCNC(=O)c2ccc(-c3ccc(O)cc3)cc2)cc1)C(=O)OCC |
| InChI | InChI=1S/C30H35NO5/c1-3-5-6-26(30(34)35-4-2)21-22-7-17-28(18-8-22)36-20-19-31-29(33)25-11-9-23(10-12-25)24-13-15-27(32)16-14-24/h7-18,26,32H,3-6,19-21H2,1-2H3,(H,31,33) |
| InChIKey | RFAZESCALJSURN-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|