C31H37NO6 — CID 18625740
2-[[4-[2-[[4-[4-(dimethoxymethyl)phenyl]benzoyl]amino]ethoxy]phenyl]methyl]hexanoic acid (PubChem CID 18625740) has the molecular formula C31H37NO6 and a molecular weight of 519.64 g/mol. Its IUPAC name is 2-[[4-[2-[[4-[4-(dimethoxymethyl)phenyl]benzoyl]amino]ethoxy]phenyl]methyl]hexanoic acid.
| Compound Name | 2-[[4-[2-[[4-[4-(dimethoxymethyl)phenyl]benzoyl]amino]ethoxy]phenyl]methyl]hexanoic acid |
|---|---|
| PubChem CID | 18625740 |
| Molecular Formula | C31H37NO6 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 2-[[4-[2-[[4-[4-(dimethoxymethyl)phenyl]benzoyl]amino]ethoxy]phenyl]methyl]hexanoic acid |
| SMILES | CCCCC(Cc1ccc(OCCNC(=O)c2ccc(-c3ccc(C(OC)OC)cc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C31H37NO6/c1-4-5-6-27(30(34)35)21-22-7-17-28(18-8-22)38-20-19-32-29(33)25-13-9-23(10-14-25)24-11-15-26(16-12-24)31(36-2)37-3/h7-18,27,31H,4-6,19-21H2,1-3H3,(H,32,33)(H,34,35) |
| InChIKey | BQFDSQGAWYSYOD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|