C29H33FO5 — CID 142194180
2-[[4-[3-[4-[(4-fluorophenyl)-hydroxymethyl]phenoxy]propoxy]phenyl]methyl]hexanoic acid (PubChem CID 142194180) has the molecular formula C29H33FO5 and a molecular weight of 480.58 g/mol. Its IUPAC name is 2-[[4-[3-[4-[(4-fluorophenyl)-hydroxymethyl]phenoxy]propoxy]phenyl]methyl]hexanoic acid.
| Compound Name | 2-[[4-[3-[4-[(4-fluorophenyl)-hydroxymethyl]phenoxy]propoxy]phenyl]methyl]hexanoic acid |
|---|---|
| PubChem CID | 142194180 |
| Molecular Formula | C29H33FO5 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | 2-[[4-[3-[4-[(4-fluorophenyl)-hydroxymethyl]phenoxy]propoxy]phenyl]methyl]hexanoic acid |
| SMILES | CCCCC(Cc1ccc(OCCCOc2ccc(C(O)c3ccc(F)cc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C29H33FO5/c1-2-3-5-24(29(32)33)20-21-6-14-26(15-7-21)34-18-4-19-35-27-16-10-23(11-17-27)28(31)22-8-12-25(30)13-9-22/h6-17,24,28,31H,2-5,18-20H2,1H3,(H,32,33) |
| InChIKey | VEBTZKGYBMKEEE-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|