C11H13FO3 — CID 79418299
2-[(4-fluorophenyl)methyl]-4-hydroxybutanoic acid (PubChem CID 79418299) has the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-4-hydroxybutanoic acid.
| Compound Name | 2-[(4-fluorophenyl)methyl]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 79418299 |
| Molecular Formula | C11H13FO3 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-4-hydroxybutanoic acid |
| SMILES | O=C(O)C(CCO)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C11H13FO3/c12-10-3-1-8(2-4-10)7-9(5-6-13)11(14)15/h1-4,9,13H,5-7H2,(H,14,15) |
| InChIKey | QRDMCOPYOJBJAK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |