2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid

C16H13F3O2 — CID 114930793

IUPAC2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid
SMILESO=C(O)C(Cc1ccc(F)cc1)Cc1c(F)cccc1F
InChIInChI=1S/C16H13F3O2/c17-12-6-4-10(5-7-12)8-11(16(20)21)9-13-14(18)2-1-3-15(13)19/h1-7,11H,8-9H2,(H,20,21)
InChIKeyIHDDWTXXTKHSAF-UHFFFAOYSA-N
MW294.27 g/mol
LogP3.59
Rot. Bonds5

About 2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid

2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid (PubChem CID 114930793) has the molecular formula C16H13F3O2 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid.

Molecular Properties

Compound Name2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid
PubChem CID114930793
Molecular FormulaC16H13F3O2
Molecular Weight294.27 g/mol
Exact Mass294.09
IUPAC Name2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid
SMILESO=C(O)C(Cc1ccc(F)cc1)Cc1c(F)cccc1F
InChIInChI=1S/C16H13F3O2/c17-12-6-4-10(5-7-12)8-11(16(20)21)9-13-14(18)2-1-3-15(13)19/h1-7,11H,8-9H2,(H,20,21)
InChIKeyIHDDWTXXTKHSAF-UHFFFAOYSA-N
XLogP3.59
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.27
LogP ≤ 53.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid?
The IUPAC name of 2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid (CID 114930793) is 2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid.
What is the SMILES notation for 2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid?
The canonical SMILES for 2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid is O=C(O)C(Cc1ccc(F)cc1)Cc1c(F)cccc1F.
What is the InChIKey of 2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid?
The InChIKey is IHDDWTXXTKHSAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3O2/c17-12-6-4-10(5-7-12)8-11(16(20)21)9-13-14(18)2-1-3-15(13)19/h1-7,11H,8-9H2,(H,20,21).
What are the key properties of 2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid?
2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid has a molecular weight of 294.27 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-difluorophenyl)methyl]-3-(4-fluorophenyl)propanoic acid is sourced from PubChem (CID 114930793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).