C11H12ClFO2 — CID 42327538
(2R)-2-[(2-chloro-6-fluorophenyl)methyl]butanoic acid (PubChem CID 42327538) has the molecular formula C11H12ClFO2 and a molecular weight of 230.67 g/mol. Its IUPAC name is (2R)-2-[(2-chloro-6-fluorophenyl)methyl]butanoic acid.
| Compound Name | (2R)-2-[(2-chloro-6-fluorophenyl)methyl]butanoic acid |
|---|---|
| PubChem CID | 42327538 |
| Molecular Formula | C11H12ClFO2 |
| Molecular Weight | 230.67 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | (2R)-2-[(2-chloro-6-fluorophenyl)methyl]butanoic acid |
| SMILES | CC[C@H](Cc1c(F)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H12ClFO2/c1-2-7(11(14)15)6-8-9(12)4-3-5-10(8)13/h3-5,7H,2,6H2,1H3,(H,14,15)/t7-/m1/s1 |
| InChIKey | SXBLXRWPFGQLTO-SSDOTTSWSA-N |
| XLogP | 3.13 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.67 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |