C16H23FO3 — CID 61484221
2-[(4-fluorophenyl)methyl]-4-(3-methylbutoxy)butanoic acid (PubChem CID 61484221) has the molecular formula C16H23FO3 and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methyl]-4-(3-methylbutoxy)butanoic acid.
| Compound Name | 2-[(4-fluorophenyl)methyl]-4-(3-methylbutoxy)butanoic acid |
|---|---|
| PubChem CID | 61484221 |
| Molecular Formula | C16H23FO3 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 2-[(4-fluorophenyl)methyl]-4-(3-methylbutoxy)butanoic acid |
| SMILES | CC(C)CCOCCC(Cc1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C16H23FO3/c1-12(2)7-9-20-10-8-14(16(18)19)11-13-3-5-15(17)6-4-13/h3-6,12,14H,7-11H2,1-2H3,(H,18,19) |
| InChIKey | FKZWXCRPKHFVJJ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|