C16H23BrO3 — CID 61484392
2-[(2-bromophenyl)methyl]-4-(3-methylbutoxy)butanoic acid (PubChem CID 61484392) has the molecular formula C16H23BrO3 and a molecular weight of 343.26 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methyl]-4-(3-methylbutoxy)butanoic acid.
| Compound Name | 2-[(2-bromophenyl)methyl]-4-(3-methylbutoxy)butanoic acid |
|---|---|
| PubChem CID | 61484392 |
| Molecular Formula | C16H23BrO3 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-[(2-bromophenyl)methyl]-4-(3-methylbutoxy)butanoic acid |
| SMILES | CC(C)CCOCCC(Cc1ccccc1Br)C(=O)O |
| InChI | InChI=1S/C16H23BrO3/c1-12(2)7-9-20-10-8-14(16(18)19)11-13-5-3-4-6-15(13)17/h3-6,12,14H,7-11H2,1-2H3,(H,18,19) |
| InChIKey | PJXPRJNXVNHRRV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|