C12H15BrO3 — CID 103984138
2-[(2-bromophenyl)methyl]-3-ethoxypropanoic acid (PubChem CID 103984138) has the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methyl]-3-ethoxypropanoic acid.
| Compound Name | 2-[(2-bromophenyl)methyl]-3-ethoxypropanoic acid |
|---|---|
| PubChem CID | 103984138 |
| Molecular Formula | C12H15BrO3 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 2-[(2-bromophenyl)methyl]-3-ethoxypropanoic acid |
| SMILES | CCOCC(Cc1ccccc1Br)C(=O)O |
| InChI | InChI=1S/C12H15BrO3/c1-2-16-8-10(12(14)15)7-9-5-3-4-6-11(9)13/h3-6,10H,2,7-8H2,1H3,(H,14,15) |
| InChIKey | DJEMWQRTIRKNMJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |