C13H14BrClO2 — CID 106439362
(Z)-2-[(2-bromophenyl)methyl]-5-chloro-4-methylpent-4-enoic acid (PubChem CID 106439362) has the molecular formula C13H14BrClO2 and a molecular weight of 317.61 g/mol. Its IUPAC name is (Z)-2-[(2-bromophenyl)methyl]-5-chloro-4-methylpent-4-enoic acid.
| Compound Name | (Z)-2-[(2-bromophenyl)methyl]-5-chloro-4-methylpent-4-enoic acid |
|---|---|
| PubChem CID | 106439362 |
| Molecular Formula | C13H14BrClO2 |
| Molecular Weight | 317.61 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | (Z)-2-[(2-bromophenyl)methyl]-5-chloro-4-methylpent-4-enoic acid |
| SMILES | C/C(=C/Cl)CC(Cc1ccccc1Br)C(=O)O |
| InChI | InChI=1S/C13H14BrClO2/c1-9(8-15)6-11(13(16)17)7-10-4-2-3-5-12(10)14/h2-5,8,11H,6-7H2,1H3,(H,16,17)/b9-8- |
| InChIKey | DCFABRFMOBKKSP-HJWRWDBZSA-N |
| XLogP | 4.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |