C15H22O4 — CID 106454843
2-[(4-methoxyphenyl)methyl]-4-propoxybutanoic acid (PubChem CID 106454843) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methyl]-4-propoxybutanoic acid.
| Compound Name | 2-[(4-methoxyphenyl)methyl]-4-propoxybutanoic acid |
|---|---|
| PubChem CID | 106454843 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-[(4-methoxyphenyl)methyl]-4-propoxybutanoic acid |
| SMILES | CCCOCCC(Cc1ccc(OC)cc1)C(=O)O |
| InChI | InChI=1S/C15H22O4/c1-3-9-19-10-8-13(15(16)17)11-12-4-6-14(18-2)7-5-12/h4-7,13H,3,8-11H2,1-2H3,(H,16,17) |
| InChIKey | VIUFWEMTAFQCIJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|