C11H14O3 — CID 10535804
3-(4-methoxyphenyl)-2-methylpropanoic acid (PubChem CID 10535804) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-2-methylpropanoic acid.
| Compound Name | 3-(4-methoxyphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 10535804 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-(4-methoxyphenyl)-2-methylpropanoic acid |
| SMILES | COc1ccc(CC(C)C(=O)O)cc1 |
| InChI | InChI=1S/C11H14O3/c1-8(11(12)13)7-9-3-5-10(14-2)6-4-9/h3-6,8H,7H2,1-2H3,(H,12,13) |
| InChIKey | ZLBZKSGFGIEZGQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |