C21H23NO5 — CID 120690042
3-[4-[[4-(4-methoxyphenyl)-4-oxobutanoyl]amino]phenyl]-2-methylpropanoic acid (PubChem CID 120690042) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 3-[4-[[4-(4-methoxyphenyl)-4-oxobutanoyl]amino]phenyl]-2-methylpropanoic acid.
| Compound Name | 3-[4-[[4-(4-methoxyphenyl)-4-oxobutanoyl]amino]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120690042 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 3-[4-[[4-(4-methoxyphenyl)-4-oxobutanoyl]amino]phenyl]-2-methylpropanoic acid |
| SMILES | COc1ccc(C(=O)CCC(=O)Nc2ccc(CC(C)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C21H23NO5/c1-14(21(25)26)13-15-3-7-17(8-4-15)22-20(24)12-11-19(23)16-5-9-18(27-2)10-6-16/h3-10,14H,11-13H2,1-2H3,(H,22,24)(H,25,26) |
| InChIKey | JSJALNGMKHSKOA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |