C10H14ClNO3 — CID 24802313
(2S)-2-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride (PubChem CID 24802313) has the molecular formula C10H14ClNO3 and a molecular weight of 231.68 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride.
| Compound Name | (2S)-2-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 24802313 |
| Molecular Formula | C10H14ClNO3 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | (2S)-2-amino-3-(4-methoxyphenyl)propanoic acid;hydrochloride |
| SMILES | COc1ccc(C[C@H](N)C(=O)O)cc1.Cl |
| InChI | InChI=1S/C10H13NO3.ClH/c1-14-8-4-2-7(3-5-8)6-9(11)10(12)13;/h2-5,9H,6,11H2,1H3,(H,12,13);1H/t9-;/m0./s1 |
| InChIKey | OWJANEXICRZDJT-FVGYRXGTSA-N |
| XLogP | 1.07 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |