C10H14BNO5 — CID 175188819
2-amino-3-[4-[hydroxy(methoxy)boranyl]oxyphenyl]propanoic acid (PubChem CID 175188819) has the molecular formula C10H14BNO5 and a molecular weight of 239.04 g/mol. Its IUPAC name is 2-amino-3-[4-[hydroxy(methoxy)boranyl]oxyphenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[hydroxy(methoxy)boranyl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 175188819 |
| Molecular Formula | C10H14BNO5 |
| Molecular Weight | 239.04 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-amino-3-[4-[hydroxy(methoxy)boranyl]oxyphenyl]propanoic acid |
| SMILES | COB(O)Oc1ccc(CC(N)C(=O)O)cc1 |
| InChI | InChI=1S/C10H14BNO5/c1-16-11(15)17-8-4-2-7(3-5-8)6-9(12)10(13)14/h2-5,9,15H,6,12H2,1H3,(H,13,14) |
| InChIKey | UWOWWLYHTKJRND-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.04 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|