C15H18I3NO4 — CID 159230328
(2S)-2-amino-3-[4-(4-hydroxyphenoxy)phenyl]propanoic acid;trihydroiodide (PubChem CID 159230328) has the molecular formula C15H18I3NO4 and a molecular weight of 657.02 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-(4-hydroxyphenoxy)phenyl]propanoic acid;trihydroiodide.
| Compound Name | (2S)-2-amino-3-[4-(4-hydroxyphenoxy)phenyl]propanoic acid;trihydroiodide |
|---|---|
| PubChem CID | 159230328 |
| Molecular Formula | C15H18I3NO4 |
| Molecular Weight | 657.02 g/mol |
| Exact Mass | 656.84 |
| IUPAC Name | (2S)-2-amino-3-[4-(4-hydroxyphenoxy)phenyl]propanoic acid;trihydroiodide |
| SMILES | I.I.I.N[C@@H](Cc1ccc(Oc2ccc(O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C15H15NO4.3HI/c16-14(15(18)19)9-10-1-5-12(6-2-10)20-13-7-3-11(17)4-8-13;;;/h1-8,14,17H,9,16H2,(H,18,19);3*1H/t14-;;;/m0.../s1 |
| InChIKey | IKMKOQRSXMLLRK-ZSOSHZMMSA-N |
| XLogP | 3.99 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.02 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|