C18H20N2O5 — CID 70292963
2-amino-3-[4-[(2R)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxyphenyl]propanoic acid (PubChem CID 70292963) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is 2-amino-3-[4-[(2R)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxyphenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[(2R)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 70292963 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2-amino-3-[4-[(2R)-2-amino-3-(4-hydroxyphenyl)propanoyl]oxyphenyl]propanoic acid |
| SMILES | NC(Cc1ccc(OC(=O)[C@H](N)Cc2ccc(O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C18H20N2O5/c19-15(17(22)23)9-12-3-7-14(8-4-12)25-18(24)16(20)10-11-1-5-13(21)6-2-11/h1-8,15-16,21H,9-10,19-20H2,(H,22,23)/t15?,16-/m1/s1 |
| InChIKey | OUTFKSHSUPFSIY-OEMAIJDKSA-N |
| XLogP | 0.82 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|