C10H14NO5P — CID 141175288
(2S)-2-amino-3-[4-[hydroxy(methyl)phosphoryl]oxyphenyl]propanoic acid (PubChem CID 141175288) has the molecular formula C10H14NO5P and a molecular weight of 259.20 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[hydroxy(methyl)phosphoryl]oxyphenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[hydroxy(methyl)phosphoryl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 141175288 |
| Molecular Formula | C10H14NO5P |
| Molecular Weight | 259.20 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | (2S)-2-amino-3-[4-[hydroxy(methyl)phosphoryl]oxyphenyl]propanoic acid |
| SMILES | CP(=O)(O)Oc1ccc(C[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C10H14NO5P/c1-17(14,15)16-8-4-2-7(3-5-8)6-9(11)10(12)13/h2-5,9H,6,11H2,1H3,(H,12,13)(H,14,15)/t9-/m0/s1 |
| InChIKey | WSVUQBBZNSNLLC-VIFPVBQESA-N |
| XLogP | 0.83 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.20 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|