C12H19O4P — CID 159637642
methyl-[4-[(2S)-2-methyl-3-oxobutyl]phenoxy]phosphinic acid;molecular hydrogen (PubChem CID 159637642) has the molecular formula C12H19O4P and a molecular weight of 258.25 g/mol. Its IUPAC name is methyl-[4-[(2S)-2-methyl-3-oxobutyl]phenoxy]phosphinic acid;molecular hydrogen.
| Compound Name | methyl-[4-[(2S)-2-methyl-3-oxobutyl]phenoxy]phosphinic acid;molecular hydrogen |
|---|---|
| PubChem CID | 159637642 |
| Molecular Formula | C12H19O4P |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | methyl-[4-[(2S)-2-methyl-3-oxobutyl]phenoxy]phosphinic acid;molecular hydrogen |
| SMILES | CC(=O)[C@@H](C)Cc1ccc(OP(C)(=O)O)cc1.[H][H] |
| InChI | InChI=1S/C12H17O4P.H2/c1-9(10(2)13)8-11-4-6-12(7-5-11)16-17(3,14)15;/h4-7,9H,8H2,1-3H3,(H,14,15);1H/t9-;/m0./s1 |
| InChIKey | MPYCYAGLKBZESM-FVGYRXGTSA-N |
| XLogP | 2.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|