C9H11FNO6P — CID 54033504
(2S)-2-(fluoroamino)-3-(4-phosphonooxyphenyl)propanoic acid (PubChem CID 54033504) has the molecular formula C9H11FNO6P and a molecular weight of 279.16 g/mol. Its IUPAC name is (2S)-2-(fluoroamino)-3-(4-phosphonooxyphenyl)propanoic acid.
| Compound Name | (2S)-2-(fluoroamino)-3-(4-phosphonooxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 54033504 |
| Molecular Formula | C9H11FNO6P |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | (2S)-2-(fluoroamino)-3-(4-phosphonooxyphenyl)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)NF |
| InChI | InChI=1S/C9H11FNO6P/c10-11-8(9(12)13)5-6-1-3-7(4-2-6)17-18(14,15)16/h1-4,8,11H,5H2,(H,12,13)(H2,14,15,16)/t8-/m0/s1 |
| InChIKey | LHHBHRXMBKZVLP-QMMMGPOBSA-N |
| XLogP | 0.63 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|