C21H32N5O12P — CID 134826569
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-phosphonooxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]propanoic acid (PubChem CID 134826569) has the molecular formula C21H32N5O12P and a molecular weight of 577.48 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-phosphonooxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-phosphonooxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 134826569 |
| Molecular Formula | C21H32N5O12P |
| Molecular Weight | 577.48 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-3-hydroxypropanoyl]amino]-3-(4-phosphonooxyphenyl)propanoyl]amino]-3-hydroxypropanoyl]amino]propanoic acid |
| SMILES | C[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(OP(=O)(O)O)cc1)C(=O)N[C@@H](CO)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C21H32N5O12P/c1-10(22)17(29)25-16(9-28)20(32)24-14(7-12-3-5-13(6-4-12)38-39(35,36)37)18(30)26-15(8-27)19(31)23-11(2)21(33)34/h3-6,10-11,14-16,27-28H,7-9,22H2,1-2H3,(H,23,31)(H,24,32)(H,25,29)(H,26,30)(H,33,34)(H2,35,36,37)/t10-,11-,14-,15-,16-/m0/s1 |
| InChIKey | GVKLPMOHCYCICQ-FQDAJMMCSA-N |
| XLogP | -3.92 |
| TPSA | 286.94 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.48 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|