C15H21N3O5 — CID 23195525
2-[[2-(2-aminopropanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]propanoic acid (PubChem CID 23195525) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-[[2-(2-aminopropanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-(2-aminopropanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23195525 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-[[2-(2-aminopropanoylamino)-3-(4-hydroxyphenyl)propanoyl]amino]propanoic acid |
| SMILES | CC(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C15H21N3O5/c1-8(16)13(20)18-12(14(21)17-9(2)15(22)23)7-10-3-5-11(19)6-4-10/h3-6,8-9,12,19H,7,16H2,1-2H3,(H,17,21)(H,18,20)(H,22,23) |
| InChIKey | AENHOIXXHKNIQL-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |