C12H17ClN2O4 — CID 171150433
2-(2-aminopropanoylamino)-3-(4-hydroxyphenyl)propanoic acid;hydrochloride (PubChem CID 171150433) has the molecular formula C12H17ClN2O4 and a molecular weight of 288.73 g/mol. Its IUPAC name is 2-(2-aminopropanoylamino)-3-(4-hydroxyphenyl)propanoic acid;hydrochloride.
| Compound Name | 2-(2-aminopropanoylamino)-3-(4-hydroxyphenyl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 171150433 |
| Molecular Formula | C12H17ClN2O4 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-(2-aminopropanoylamino)-3-(4-hydroxyphenyl)propanoic acid;hydrochloride |
| SMILES | CC(N)C(=O)NC(Cc1ccc(O)cc1)C(=O)O.Cl |
| InChI | InChI=1S/C12H16N2O4.ClH/c1-7(13)11(16)14-10(12(17)18)6-8-2-4-9(15)5-3-8;/h2-5,7,10,15H,6,13H2,1H3,(H,14,16)(H,17,18);1H |
| InChIKey | RALSEZWFSSOPKE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |