C24H34N4O12P2 — CID 162451282
(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(4-phosphonooxyphenyl)propanoyl]amino]hexanoyl]amino]-3-(4-phosphonooxyphenyl)propanoic acid (PubChem CID 162451282) has the molecular formula C24H34N4O12P2 and a molecular weight of 632.50 g/mol. Its IUPAC name is (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(4-phosphonooxyphenyl)propanoyl]amino]hexanoyl]amino]-3-(4-phosphonooxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(4-phosphonooxyphenyl)propanoyl]amino]hexanoyl]amino]-3-(4-phosphonooxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 162451282 |
| Molecular Formula | C24H34N4O12P2 |
| Molecular Weight | 632.50 g/mol |
| Exact Mass | 632.16 |
| IUPAC Name | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-3-(4-phosphonooxyphenyl)propanoyl]amino]hexanoyl]amino]-3-(4-phosphonooxyphenyl)propanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@@H](N)Cc1ccc(OP(=O)(O)O)cc1)C(=O)N[C@@H](Cc1ccc(OP(=O)(O)O)cc1)C(=O)O |
| InChI | InChI=1S/C24H34N4O12P2/c25-12-2-1-3-20(27-22(29)19(26)13-15-4-8-17(9-5-15)39-41(33,34)35)23(30)28-21(24(31)32)14-16-6-10-18(11-7-16)40-42(36,37)38/h4-11,19-21H,1-3,12-14,25-26H2,(H,27,29)(H,28,30)(H,31,32)(H2,33,34,35)(H2,36,37,38)/t19-,20-,21-/m0/s1 |
| InChIKey | VRTXLTRHCFPBFS-ACRUOGEOSA-N |
| XLogP | -0.07 |
| TPSA | 281.06 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.50 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|