C21H27N4O8P — CID 10391018
4-methyl-2-[[2-[(5-methylpyrazine-2-carbonyl)amino]-3-(4-phosphonooxyphenyl)propanoyl]amino]pentanoic acid (PubChem CID 10391018) has the molecular formula C21H27N4O8P and a molecular weight of 494.44 g/mol. Its IUPAC name is 4-methyl-2-[[2-[(5-methylpyrazine-2-carbonyl)amino]-3-(4-phosphonooxyphenyl)propanoyl]amino]pentanoic acid.
| Compound Name | 4-methyl-2-[[2-[(5-methylpyrazine-2-carbonyl)amino]-3-(4-phosphonooxyphenyl)propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 10391018 |
| Molecular Formula | C21H27N4O8P |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | 4-methyl-2-[[2-[(5-methylpyrazine-2-carbonyl)amino]-3-(4-phosphonooxyphenyl)propanoyl]amino]pentanoic acid |
| SMILES | Cc1cnc(C(=O)NC(Cc2ccc(OP(=O)(O)O)cc2)C(=O)NC(CC(C)C)C(=O)O)cn1 |
| InChI | InChI=1S/C21H27N4O8P/c1-12(2)8-17(21(28)29)25-19(26)16(24-20(27)18-11-22-13(3)10-23-18)9-14-4-6-15(7-5-14)33-34(30,31)32/h4-7,10-12,16-17H,8-9H2,1-3H3,(H,24,27)(H,25,26)(H,28,29)(H2,30,31,32) |
| InChIKey | NAPZXRYYCPYRCG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 188.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|