C27H40N5O13P — CID 73350151
(4S)-4-[[(2S)-2-[[(2S)-2-acetamido-3-(4-phosphonooxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-5-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 73350151) has the molecular formula C27H40N5O13P and a molecular weight of 673.61 g/mol. Its IUPAC name is (4S)-4-[[(2S)-2-[[(2S)-2-acetamido-3-(4-phosphonooxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-5-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (4S)-4-[[(2S)-2-[[(2S)-2-acetamido-3-(4-phosphonooxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-5-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 73350151 |
| Molecular Formula | C27H40N5O13P |
| Molecular Weight | 673.61 g/mol |
| Exact Mass | 673.24 |
| IUPAC Name | (4S)-4-[[(2S)-2-[[(2S)-2-acetamido-3-(4-phosphonooxyphenyl)propanoyl]amino]-4-carboxybutanoyl]amino]-5-[[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(=O)N[C@@H](Cc1ccc(OP(=O)(O)O)cc1)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(C)C)C(N)=O |
| InChI | InChI=1S/C27H40N5O13P/c1-14(2)12-20(24(28)38)32-26(40)19(9-11-23(36)37)30-25(39)18(8-10-22(34)35)31-27(41)21(29-15(3)33)13-16-4-6-17(7-5-16)45-46(42,43)44/h4-7,14,18-21H,8-13H2,1-3H3,(H2,28,38)(H,29,33)(H,30,39)(H,31,41)(H,32,40)(H,34,35)(H,36,37)(H2,42,43,44)/t18-,19-,20-,21-/m0/s1 |
| InChIKey | WSSSIQJLLQJNNM-TUFLPTIASA-N |
| XLogP | -1.08 |
| TPSA | 300.85 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.61 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|